ChemNet > CAS > 19404-18-3 5-chloro-3-methylbenzo[b]thiophene
19404-18-3 5-chloro-3-methylbenzo[b]thiophene
Naam product |
5-chloro-3-methylbenzo[b]thiophene |
Synoniemen |
5-Chloro-3-methylthianaphthene; 5-chloro-3-methyl-1-benzothiophene |
MF |
C9H7ClS |
Molecuulgewicht |
182.6699 |
InChI |
InChI=1/C9H7ClS/c1-6-5-11-9-3-2-7(10)4-8(6)9/h2-5H,1H3 |
CAS-nummer |
19404-18-3 |
Moleculaire Structuur |
|
Dichtheid |
1.293g/cm3 |
Smeltpunt |
32℃ |
Kookpunt |
280.5°C at 760 mmHg |
Brekingsindex |
1.66 |
Vlampunt |
163.1°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|